A4719212
Halosulfuron-methyl , Analysis standard product, 99.5% , 100784-20-1
Synonym(s):
Methyl 3-chloro-5-(4,6-dimethoxy-2-pyrimidinylcarbamoylsulfamoyl)-1-methylpyrazole-4-carboxylate
CAS NO.:100784-20-1
Empirical Formula: C13H15ClN6O7S
Molecular Weight: 434.81
MDL number: MFCD01631160
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB286.40 | In Stock |
|
| 1g | RMB1719.20 | In Stock |
|
| 5g | RMB5999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-177°C |
| Density | 1.618 |
| storage temp. | 0-6°C |
| Water Solubility | Insoluble in water |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| pka | 11.96±0.70(Predicted) |
| color | White to Light yellow to Light orange |
| Merck | 14,4602 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C13H15ClN6O7S/c1-20-10(8(9(14)18-20)11(21)27-4)28(23,24)19-13(22)17-12-15-6(25-2)5-7(16-12)26-3/h5H,1-4H3,(H2,15,16,17,19,22) |
| InChIKey | FMGZEUWROYGLAY-UHFFFAOYSA-N |
| SMILES | N1(C)C(S(NC(NC2=NC(OC)=CC(OC)=N2)=O)(=O)=O)=C(C(OC)=O)C(Cl)=N1 |
| CAS DataBase Reference | 100784-20-1(CAS DataBase Reference) |
| EPA Substance Registry System | Halosulfuron-methyl (100784-20-1) |
Description and Uses
Herbicide.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H360D-H410 |
| Precautionary statements | P202-P273-P280-P308+P313-P391-P405 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | UQ6392606 |
| HS Code | 2935.90.9500 |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Repr. 1B |
| Toxicity | LD50 orally in rats: 8865 mg/kg; dermally in rabbits: >2000 mg/kg; LC50 (4 hr) in rats: >4.3 mg/l (Suzuki) |







