A4719431
(S)-4-Bromo-α-methylbenzyl alcohol , 95% , 100760-04-1
Synonym(s):
(S)-1-(4-Bromophenyl)ethanol;(S)-4′-Bromo-1-phenylethanol
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB76.00 | In Stock |
|
| 250MG | RMB236.00 | In Stock |
|
| 1G | RMB563.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 116 °C(Press: 5.2 Torr) |
| Density | 1.322 g/mL at 25 °C |
| refractive index | n20/D 1.570 |
| Flash point: | 110 °C |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| pka | 14.22±0.20(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| optical activity | [α]20/D -38.0°, c = 1 in chloroform |
| InChI | InChI=1/C8H9BrO/c1-6(10)7-2-4-8(9)5-3-7/h2-6,10H,1H3/t6-/s3 |
| InChIKey | XTDTYSBVMBQIBT-LURJTMIESA-N |
| SMILES | C1([C@H](C)O)=CC=C(C=C1)Br |&1:1,r| |
| CAS DataBase Reference | 100760-04-1 |
Description and Uses
(S)-1-(4-Bromophenyl)ethanol is a building block used in organic synthesis of photochemically active and photophysical pthalocyanines.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26 |
| WGK Germany | 3 |
| HS Code | 29062990 |
