A4722112
Cis-4-Hydroxy-L-proline , 98% , 618-27-9
Synonym(s):
(2S,4S)-(−)-4-Hydroxy-2-pyrrolidinecarboxylic acid;CHP
CAS NO.:618-27-9
Empirical Formula: C5H9NO3
Molecular Weight: 131.13
MDL number: MFCD00064319
EINECS: 210-542-1
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB28.00 | In Stock |
|
| 250MG | RMB58.40 | In Stock |
|
| 1G | RMB133.60 | In Stock |
|
| 5g | RMB388.80 | In Stock |
|
| 25g | RMB1236.00 | In Stock |
|
| 100g | RMB5039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 257 °C (dec.) (lit.) |
| alpha | -59 º (c=2, H2O) |
| Boiling point: | 242.42°C (rough estimate) |
| Density | 1.3121 (rough estimate) |
| refractive index | -59 ° (C=2, H2O) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble |
| form | Powder |
| pka | 2.14±0.40(Predicted) |
| color | White to beige |
| Water Solubility | soluble |
| Merck | 14,4840 |
| BRN | 81440 |
| Major Application | peptide synthesis |
| InChI | 1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3-,4-/m0/s1 |
| InChIKey | PMMYEEVYMWASQN-IMJSIDKUSA-N |
| SMILES | O[C@@H]1CN[C@@H](C1)C(O)=O |
| CAS DataBase Reference | 618-27-9(CAS DataBase Reference) |
| EPA Substance Registry System | L-Proline, 4-hydroxy-, (4S)- (618-27-9) |
Description and Uses
cis-4-Hydroxy-L-proline (CHP) is a proline analog that inhibits collagen synthesis and has been used as an anticancer compound. CHP blocked myotube formation and expression of sarcomeric myosin heavy chain in C2C12 murine skeletal muscle cells. CHP inhibited proliferation of murine Panc02 pancreatic carcinoma cell line and rat pancreatic carcinoma cell line DSL6A.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |







