PRODUCT Properties
| Melting point: | 137°C |
| Boiling point: | 548.19°C (rough estimate) |
| Density | 1.0395 (rough estimate) |
| refractive index | 1.6010 (estimate) |
| storage temp. | room temp |
| solubility | Soluble in water, ethanol, chloroform; insoluble in ether, xylene |
| Colour Index | 42535 |
| form | Crystalline Powder With Metal Luster |
| color | Green with metal luster |
| PH Range | 0.1(YELLOW)-1.5(BLUE) |
| PH | 1-2 |
| Water Solubility | soluble |
| λmax | 584nm |
| BRN | 8464808 |
| Stability: | Hygroscopic |
| Biological Applications | Antimalarial agent; detecting enzyme activity,protein–protein interactions; treating diabetes,ringworm; agrochemicals; pesticides; cosmetics; wound dressing materials |
| Major Application | Display device, photoresists, solar cells, inks, highlighters, rubber, lithium battery, petroleum products, leak detection method, decoder system, packaging materials, hair dyes, cosmetics, wound dressing materials, antitumor agent, determination of nucleic acids |
| Cosmetics Ingredients Functions | HAIR DYEING |
| Cosmetic Ingredient Review (CIR) | Basic Violet 1 (8004-87-3) |
| InChI | 1S/C24H27N3.ClH/c1-25-21-12-6-18(7-13-21)24(19-8-14-22(15-9-19)26(2)3)20-10-16-23(17-11-20)27(4)5;/h6-17H,1-5H3;1H |
| InChIKey | JFTBTTPUYRGXDG-UHFFFAOYSA-N |
| SMILES | Cl.C\N=C1/C=C\C(C=C1)=C(/c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C |
| EPA Substance Registry System | C.I. Basic Violet 1 (8004-87-3) |
Description and Uses
Methyl violet 2B is a biological stain that is commonly used at a pH between 0 and 1.6. It is certified for use in Flemming triple stain with iodine for chromosomes; Newton?s crystal violet-iodine technique for chromatin and nucleoli; Lieb?s amyloid stain.
Safety
| Symbol(GHS) |     GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H318-H351-H410 |
| Precautionary statements | P202-P273-P280-P301+P312-P305+P351+P338-P308+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36-50-40 |
| Safety Statements | 26-36-24/25-22-61-36/37 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | CX9899550 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 32041300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Dam. 1 |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
