A4724431
α-naphthol phthalide indicator , 0.1%in50%Ethanol , 596-01-0
Synonym(s):
1-Naphtholphthalein
CAS NO.:596-01-0
Empirical Formula: C28H18O4
Molecular Weight: 418.44
MDL number: MFCD00036202
EINECS: 209-875-5
| Pack Size | Price | Stock | Quantity |
| 100ml | RMB71.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 238-240 °C(lit.) |
| Boiling point: | 496.21°C (rough estimate) |
| Density | 1.1532 (rough estimate) |
| bulk density | 350kg/m3 |
| vapor density | 14.44 (vs air) |
| refractive index | 1.6400 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | Solubility Practically insoluble in water; soluble in ethanol |
| pka | 8.0, 8.2, 8.5(at 25℃) |
| form | Powder |
| color | Pink to beige or brown |
| PH Range | 7.1(brownish)-8.3(blue/green) |
| PH | pH : 7.1~8.7 |
| Odor | Characteristic odour |
| Water Solubility | Soluble in ethanol. Insoluble in water. |
| λmax | 648nm |
| Merck | 14,6389 |
| BRN | 97816 |
| InChI | 1S/C28H18O4/c29-25-15-13-23(17-7-1-3-9-19(17)25)28(22-12-6-5-11-21(22)27(31)32-28)24-14-16-26(30)20-10-4-2-8-18(20)24/h1-16,29-30H |
| InChIKey | HQHBAGKIEAOSNM-UHFFFAOYSA-N |
| SMILES | O1C(c6c(cccc6)C1=O)(c4c5c(c(cc4)O)cccc5)c2c3c(c(cc2)O)cccc3 |
| CAS DataBase Reference | 596-01-0(CAS DataBase Reference) |
Description and Uses
As indicator in 0.1% or 0.04% solution in alcohol. pH 7.3 colorless to reddish; 8.7 greenish to blue. Particularly adapted for weak acids in strong alcoholic solution.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 32041900 |
| Storage Class | 11 - Combustible Solids |





