A4724812
2-Hydroxy-5-nitropyridine , 98% , 5418-51-9
Synonym(s):
5-Nitro-2-pyridinol
CAS NO.:5418-51-9
Empirical Formula: C5H4N2O3
Molecular Weight: 140.1
MDL number: MFCD00006276
EINECS: 226-525-7
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB64.00 | In Stock |
|
| 100G | RMB190.40 | In Stock |
|
| 250g | RMB423.20 | In Stock |
|
| 500g | RMB700.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-191 °C (lit.) |
| Boiling point: | 256.56°C (rough estimate) |
| Density | 1.5657 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Very Slightly) |
| form | Crystalline Powder |
| pka | 8.06±0.10(Predicted) |
| color | Light yellow to beige |
| Water Solubility | Soluble in hot water and alkali liquor, Insoluble in most of organic solvents. |
| BRN | 120352 |
| InChI | InChI=1S/C5H4N2O3/c8-5-2-1-4(3-6-5)7(9)10/h1-3H,(H,6,8) |
| InChIKey | XKWSQIMYNVLGBO-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C([N+]([O-])=O)C=C1 |
| CAS DataBase Reference | 5418-51-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Hydroxy-5-nitropyridine(5418-51-9) |
Description and Uses
A comparison of catalysts promotes imidazolide couplings including the identification of 2-hydroxy-5-nitropyridine as a new, safe, and effective catalyst.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



