A4726331
N-[5-(Phenylamino)-2,4-pentadienylidene]aniline monohydrochloride , 90% , 1497-49-0
CAS NO.:1497-49-0
Empirical Formula: C17H17ClN2
Molecular Weight: 284.78
MDL number: MFCD00012630
EINECS: 216-094-3
| Pack Size | Price | Stock | Quantity |
| 25g | RMB343.20 | In Stock |
|
| 100g | RMB951.20 | In Stock |
|
| 500g | RMB3335.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| form | Powder |
| color | Bordeaux to purple |
| Water Solubility | Soluble in methanol. Insoluble in water.. |
| Sensitive | Hygroscopic |
| BRN | 3916924 |
| Stability: | Hygroscopic |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C17H16N2.ClH/c1-4-10-16(11-5-1)18-14-8-3-9-15-19-17-12-6-2-7-13-17;/h1-15,18H;1H/b9-3+,14-8+,19-15+; |
| InChIKey | VUCMMJBDNXZQDJ-SAIFEKGMSA-N |
| SMILES | C1(N/C=C/C=C/C=N/C2C=CC=CC=2)C=CC=CC=1.Cl |
| CAS DataBase Reference | 1497-49-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, N-[5-(phenylamino)-2,4-pentadienylidene]-, monohydrochloride (1497-49-0) |
Description and Uses
Glutacondianil Hydrochloride is used as a reagent in the synthesis of novel vinylsulfone cyanine dyes used for labelling biomolecules. Dyes and metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 36/37/39-26-37/39-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29214200 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |

![N-[5-(Phenylamino)-2,4-pentadienylidene]aniline monohydrochloride](https://img.chemicalbook.com/CAS/GIF/1497-49-0.gif)




