PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| Boiling point: | 405.75°C (rough estimate) |
| Density | 2.956 |
| refractive index | 1.7040 (estimate) |
| Flash point: | -18 °C |
| storage temp. | APPROX 4°C |
| solubility | chloroform: soluble10mg/mL |
| form | solid |
| color | White to Pale Beige |
| Water Solubility | 0.11ug/L(25 ºC) |
| BRN | 1912586 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | CAYGQBVSOZLICD-UHFFFAOYSA-N |
| SMILES | Brc1c(Br)c(Br)c(Br)c(Br)c1Br |
| CAS DataBase Reference | 87-82-1(CAS DataBase Reference) |
| EPA Substance Registry System | Hexabromobenzene (87-82-1) |
Description and Uses
The porphyrinogenic potential of hexabromobenzene (HBB) with hexachlorobenzene was studied in the liver of primiparous rats.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H413 |
| Precautionary statements | P273-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xn,N,F |
| Risk Statements | 20/21/22-36/37/38-67-65-50/53-38-11 |
| Safety Statements | 26-36/37-62-61-60 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | DA2200100 |
| TSCA | TSCA listed |
| HS Code | 29039990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 87-82-1(Hazardous Substances Data) |




