A4734012
4′-Hydroxy-4-biphenylcarboxylic acid , 98% , 58574-03-1
Synonym(s):
4-(4-Hydroxyphenyl)benzoic acid
CAS NO.:58574-03-1
Empirical Formula: C13H10O3
Molecular Weight: 214.22
MDL number: MFCD00059078
EINECS: 607-884-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB116.80 | In Stock |
|
| 25G | RMB411.20 | In Stock |
|
| 100g | RMB1420.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 295 °C (dec.)(lit.) |
| Boiling point: | 314.35°C (rough estimate) |
| Density | 1.1956 (rough estimate) |
| refractive index | 1.5090 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | almost transparency in hot Methanol |
| form | Liquid or Solid |
| pka | 4.29±0.10(Predicted) |
| color | Clear colorless to yellow |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C13H10O3/c14-12-7-5-10(6-8-12)9-1-3-11(4-2-9)13(15)16/h1-8,14H,(H,15,16) |
| InChIKey | JTGCXYYDAVPSFD-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(cc1)-c2ccc(O)cc2 |
| CAS DataBase Reference | 58574-03-1(CAS DataBase Reference) |
Description and Uses
Intermediates of Liquid Crystals
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 26-37/39-37 |
| WGK Germany | 3 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |



