PRODUCT Properties
| Melting point: | 281-284 °C (dec.)(lit.) |
| alpha | 77 º (c=1% in 1N HCl) |
| Boiling point: | 507.6±50.0 °C(Predicted) |
| Density | 1.443±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | H2O : 5 mg/mL (18.63 mM; ultrasonic and adjust pH to 3 with H2O)DMSO : 1 mg/mL (3.73 mM; ultrasonic and adjust pH to 5 with HCl) |
| form | Powder |
| pka | 1.90±0.10(Predicted) |
| color | Off-white to light yellow |
| optical activity | 73.7°(C=0.97g/100ml 1N HCL) |
| BRN | 1728583 |
| InChI | InChI=1S/C8H16N2O4S2/c9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t5-,6-/m0/s1 |
| InChIKey | ZTVZLYBCZNMWCF-WDSKDSINSA-N |
| SMILES | S(CC[C@H](N)C(O)=O)SCC[C@H](N)C(O)=O |
| CAS DataBase Reference | 626-72-2(CAS DataBase Reference) |
| EPA Substance Registry System | L-Homocystine (626-72-2) |
Description and Uses
Increased levels lead to hyperhomocysteinemia; a cardiovascular risk factor in prediction of coronary heart disease as well as being associated with congenital birth defects, pregnancy complications and cancer.
Safety
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29309090 |
