A4741612
4-Hydroxy-6-methyl-2-pyrone , 99% , 675-10-5
Synonym(s):
3,5-Dihydroxysorbic acid δ-lactone
CAS NO.:675-10-5
Empirical Formula: C6H6O3
Molecular Weight: 126.11
MDL number: MFCD00006641
EINECS: 211-619-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB37.60 | In Stock |
|
| 100G | RMB115.20 | In Stock |
|
| 250g | RMB319.20 | In Stock |
|
| 500G | RMB519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-190 °C (dec.) (lit.) |
| Boiling point: | 174.21°C (rough estimate) |
| Density | 1.2048 (rough estimate) |
| refractive index | 1.4189 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | 8.6g/l |
| pka | 5.14±0.30(Predicted) |
| form | Powder |
| color | Off-white to brown |
| Water Solubility | 8.60 g/L (20 ºC) |
| BRN | 113815 |
| InChI | InChI=1S/C6H6O3/c1-4-2-5(7)3-6(8)9-4/h2-3,7H,1H3 |
| InChIKey | NSYSSMYQPLSPOD-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(C)=CC(O)=C1 |
| CAS DataBase Reference | 675-10-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2H-Pyran-2-one, 4-hydroxy-6-methyl- (675-10-5) |
Description and Uses
4-Hydroxy-6-methylpyran-2-one was used in the synthesis of pyrano[3,2-c]pyridones with antiproliferative and apoptosis inducing activities. It was also used in the design of benzisothiazolone human leukocyte elastase inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | UQ1000000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29322980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



