A4741712
Heptane-d<sub>16</sub> , D,99% , 33838-52-7
CAS NO.:33838-52-7
Empirical Formula: C7D16
Molecular Weight: 116.3
MDL number: MFCD00062744
EINECS: 680-746-7
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB479.20 | In Stock |
|
| 1G | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -91 °C(lit.) |
| Boiling point: | 98 °C(lit.) |
| Density | 0.794 g/mL at 25 °C(lit.) |
| vapor density | 3.5 (vs air) |
| vapor pressure | 40 mm Hg ( 20 °C) |
| refractive index | n |
| Flash point: | 30 °F |
| storage temp. | Flammables area |
| solubility | Difficult to mix. |
| form | Liquid |
| Sensitive | Hygroscopic |
| BRN | 1730763 |
| Stability: | Stable. Incompatible with oxidizing agents. Highly flammable. Hygroscopic. |
| InChI | 1S/C7H16/c1-3-5-7-6-4-2/h3-7H2,1-2H3/i1D3,2D3,3D2,4D2,5D2,6D2,7D2 |
| InChIKey | IMNFDUFMRHMDMM-NEBSKJCTSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 33838-52-7(CAS DataBase Reference) |
Description and Uses
n-Heptane-d16 (Reagent grade) (CAS# 33838-52-7) is a useful isotopically labeled research compound.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H225-H304-H315-H336-H410 |
| Precautionary statements | P210-P233-P273-P301+P310-P303+P361+P353-P331 |
| target organs | Central nervous system |
| Hazard Codes | F |
| Risk Statements | 11-67-65-50/53-38 |
| Safety Statements | 9-16-23-29-33-62-61-60 |
| RIDADR | UN1206 |
| WGK Germany | 3 |
| RTECS | MI7700000 |
| Autoignition Temperature | 595 °F |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 28459000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |









