2-Hydroxy-5-methyl-3-nitropyridine , 97% , 7464-14-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB63.20 | In Stock |
|
| 5G | RMB81.60 | In Stock |
|
| 25G | RMB284.00 | In Stock |
|
| 50g | RMB522.40 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 179 °C (dec.) (lit.) |
| Boiling point: | 353.3±35.0 °C(Predicted) |
| Density | 1.24 g/mL at 25 °C(lit.) |
| Flash point: | 179 °C |
| storage temp. | 2-8°C |
| solubility | Dimethylformamide[soluble in] |
| solubility | soluble in Dimethylformamide |
| form | powder to crystal |
| pka | 8.78±0.10(Predicted) |
| color | White to Yellow |
| InChI | 1S/C6H6N2O3/c1-4-2-5(8(10)11)6(9)7-3-4/h2-3H,1H3,(H,7,9) |
| InChIKey | QAINEQVHSHARMD-UHFFFAOYSA-N |
| SMILES | Cc1cnc(O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 7464-14-4(CAS DataBase Reference) |
Description and Uses
2-Hydroxy-5-methyl-3-nitropyridine (HMPN) is an organosynthetic compound that can be used as a feedstock for the synthesis of other compounds or as a biological inhibitor, such as in the preparation of 2-chloro-5-methyl-3-nitropyridine and transglutaminase 2 (tg2) inhibitors. It reacts with molybdenum and chloride. It is able to react with molybdenum and chloride, and it is able to increase the reaction yield and time. It is also used to explain its reactivity with xylene.
2-Hydroxy-5-methyl-3-nitropyridine may be used in the preparation of 2-chloro-5-methyl-3-nitropyridine via chlorination, using thionyl chloride. It may also be used is preparing proteasome inhibitors containing 5-methylpyridin-2(1H)-one moiety.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933399990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




