A4752612
Heptafluorobutyric anhydride , Used for GC derivatives, ≥99.0% , 336-59-4
Synonym(s):
HFAA;HFBA;Perfluorobutyric anhydride
CAS NO.:336-59-4
Empirical Formula: C8F14O3
Molecular Weight: 410.06
MDL number: MFCD00000432
EINECS: 206-410-8
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB607.20 | In Stock |
|
| 10×1ml | RMB1103.20 | In Stock |
|
| 25ML | RMB2391.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −43 °C(lit.) |
| Boiling point: | 108-110 °C(lit.) |
| Density | 1.674 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | None |
| storage temp. | room temp |
| solubility | Miscible with halogenated solvents. Immiscible with polar solvents. |
| form | Liquid |
| Specific Gravity | 1.653 |
| color | Colorless to Almost colorless |
| Water Solubility | REACTS |
| Sensitive | Hygroscopic |
| BRN | 856036 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C8F14O3/c9-3(10,5(13,14)7(17,18)19)1(23)25-2(24)4(11,12)6(15,16)8(20,21)22 |
| InChIKey | UFFSXJKVKBQEHC-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 336-59-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Heptafluorobutyric anhydride(336-59-4) |
| EPA Substance Registry System | Heptafluorobutyric anhydride (336-59-4) |
Description and Uses
Heptafluorobutyric anhydride (HFAA) is frequently used as an acylating agent for the derivatization of primary and secondary amines (Walle and Ehrsson, 1971). Commercially available Heptafluorobutyric anhydride may afford low yields of the derivative due to the presence of Heptafluorobutyric acid (Moodie et al., 1985). This contaminant may be removed by ditillation over phosphorus pentoxide (Walle and Ehrsson, 1970).
HFAA is used to increase volatility of an analyte, and to introduce fluorine atoms for better detection limits in gas chromatography applications.
suzuki reaction
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive/Hygroscopic |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159080 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |





