A4755012
3-Perfluorooctyl-1,2-epoxypropane , 98% , 38565-53-6
Synonym(s):
1,2-Epoxy-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11;11-heptadecafluoroundecane;2-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Heptadecafluorononyl)oxirane;3-Perfluorooctyl-1,2-epoxypropane
CAS NO.：38565-53-6
Empirical Formula: C11H5F17O
Molecular Weight: 476.13
MDL number: MFCD00042362
EINECS: 254-006-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB474.40 | In Stock |
|
| 10g | RMB759.20 | In Stock |
|
| 25G | RMB1519.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 76-78 °C |
| Boiling point: | 87 °C/19 mmHg (lit.) |
| Density | 1.712 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | clear liquid |
| Specific Gravity | 1.714 |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C11H5F17O/c12-4(13,1-3-2-29-3)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)28/h3H,1-2H2 |
| InChIKey | HMXSIEIEXLGIET-UHFFFAOYSA-N |
| SMILES | O1CC1CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 38565-53-6(CAS DataBase Reference) |
| EPA Substance Registry System | 3-(Perfluorooctyl)-1,2-propenoxide (38565-53-6) |
Description and Uses
3-(Perfluorooctyl)-1,2-propenoxide is a fluorinated epoxide with antibacterial properties.
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H318-H351-H360D-H362-H372 |
| Precautionary statements | P263-P280-P301+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29109000 |
