A4755212
5-Hydroxy-1H-indazole , 97% , 15579-15-4
Synonym(s):
1H-Indazol-5-ol
| Pack Size | Price | Stock | Quantity |
| 1G | RMB57.60 | In Stock |
|
| 5G | RMB214.40 | In Stock |
|
| 25g | RMB692.80 | In Stock |
|
| 100g | RMB1809.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-191°C |
| Boiling point: | 366.5±15.0 °C(Predicted) |
| Density | 1.434±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 9.22±0.40(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C7H6N2O/c10-6-1-2-7-5(3-6)4-8-9-7/h1-4,10H,(H,8,9) |
| InChIKey | ZHDXWEPRYNHNDC-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=C(O)C=C2)C=N1 |
| CAS DataBase Reference | 15579-15-4(CAS DataBase Reference) |
Description and Uses
5-Hydroxy-1H-indazole is a possible Rho kinase inhibitor. It is also used to discover (sulfamoylphenyl)indazolyl acetamides and carboxamides as inhibitors of mitotic kinase TTK.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P301+P312+P330-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2933998090 |
