A4758212
Methyl (R)-3-hydroxybutyrate , ≥98.0%(GC) , 3976-69-0
CAS NO.:3976-69-0
Empirical Formula: C5H10O3
Molecular Weight: 118.13
MDL number: MFCD00063289
EINECS: 223-610-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.80 | In Stock |
|
| 10G | RMB44.00 | In Stock |
|
| 25G | RMB51.20 | In Stock |
|
| 100G | RMB160.80 | In Stock |
|
| 500G | RMB557.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -21.5 º (neat) |
| Boiling point: | 56-58 °C/11 mmHg (lit.) |
| Density | 1.055 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 161 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| pka | 13.95±0.20(Predicted) |
| color | Colourless |
| optical activity | [α]20/D 19.5°, neat |
| Water Solubility | Slightly soluble in water. |
| BRN | 3648161 |
| InChI | InChI=1S/C5H10O3/c1-4(6)3-5(7)8-2/h4,6H,3H2,1-2H3/t4-/m1/s1 |
| InChIKey | LDLDJEAVRNAEBW-SCSAIBSYSA-N |
| SMILES | C(OC)(=O)C[C@H](O)C |
| LogP | -0.412 (est) |
| CAS DataBase Reference | 3976-69-0(CAS DataBase Reference) |
Description and Uses
Methyl (R)-3-hydroxybutyrate may be used in the preparation of (R)-(-)-3-hydroxybutanoic acid and poly-(R)-(-)-3-hydroxybutyrate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37-24/25-23 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 29181990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







