A4758257
Trillin , 98% , 14144-06-0
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB479.20 | In Stock |
|
| 10mg | RMB799.20 | In Stock |
|
| 25mg | RMB1439.20 | In Stock |
|
| 50mg | RMB2399.20 | In Stock |
|
| 100mg | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 275~280℃ |
| Boiling point: | 705.1±60.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMF:1.0(Max Conc. mg/mL);1.73(Max Conc. mM) DMSO:63.0(Max Conc. mg/mL);109.23(Max Conc. mM) DMSO:PBS (pH 7.2) (1:2):0.33(Max Conc. mg/mL);0.57(Max Conc. mM) |
| form | A solid |
| pka | 12.91±0.70(Predicted) |
| color | White to off-white |
| Major Application | food and beverages |
| InChIKey | WXMARHKAXWRNDM-DAOPZNMBNA-N |
| SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)OC2CC[C@@]3([C@@H]4[C@H]([C@H]5[C@@]([C@@H]6[C@@H](O[C@@]7(OC[C@@H](CC7)C)[C@H]6C)C5)(CC4)C)CC=C3C2)C |
Description and Uses
Polyphyllin A can be useful in computational NMR and molecular docking scrutiny of potential natural SARS-CoV-2 Mpro inhibitors.
Safety
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |




![(25S)-1β-[2-O-(3-O-D-Apio-β-D-furanosyl-α-L-rhamnopyranosyl)-3-O-β-D-xylopyranosyl-α-L-arabinopyranosyloxy]-3β,21,23α,24β-tetrahydroxy-18-norspirosta-5,13-diene-15-one](https://img.chemicalbook.com/CAS/20180906/GIF/58809-09-9.gif)

