A4759112
2-Hydroxy-4-methyl-3-nitropyridine , 98% , 21901-18-8
Synonym(s):
4-Methyl-3-nitro-2-pyridone
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.80 | In Stock |
|
| 5G | RMB98.40 | In Stock |
|
| 25g | RMB424.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-232 °C(lit.) |
| Boiling point: | 277.46°C (rough estimate) |
| Density | 1.4564 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Store at room temperature |
| solubility | soluble in Dimethylformamide |
| form | Crystalline Solid |
| pka | 8.40±0.10(Predicted) |
| color | Pale yellow |
| BRN | 139125 |
| InChI | InChI=1S/C6H6N2O3/c1-4-2-3-7-6(9)5(4)8(10)11/h2-3H,1H3,(H,7,9) |
| InChIKey | HZCWTTHQRMHIIE-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC(C)=C1[N+]([O-])=O |
| CAS DataBase Reference | 21901-18-8(CAS DataBase Reference) |
Description and Uses
The conformational stability and the vibartional analysis of 2-hydroxy-4-methyl-3-nitropyridine was studied.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



