A4760612
Hexaketocyclohexane octahydrate , 99% , 527-31-1
CAS NO.：527-31-1
Empirical Formula: C6O6
Molecular Weight: 168.06
MDL number: MFCD00149074
EINECS: 208-412-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB31.20 | In Stock |
|
| 2g | RMB63.20 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 10g | RMB199.20 | In Stock |
|
| 25G | RMB438.40 | In Stock |
|
| 100g | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99 °C (dec.)(lit.) |
| Boiling point: | 344.7±25.0 °C(Predicted) |
| Density | 1.967±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Powder |
| color | Beige to gray-brown |
| BRN | 2091040 |
| InChI | InChI=1S/C6O6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
| InChIKey | MQIMWEBORAIJPP-UHFFFAOYSA-N |
| SMILES | C1(=O)C(=O)C(=O)C(=O)C(=O)C1=O |
Description and Uses
Hexaketocyclohexane octahydrate has been used in the preparation of hexaazatriphenylenehexacarbonitrile.
