A4762012
2-Hydroxynicotinic Acid , 99% , 609-71-2
Synonym(s):
2-Hydroxynicotinic acid;2-Hydroxypyridine-3-carboxylic acid
CAS NO.:609-71-2
Empirical Formula: C6H5NO3
Molecular Weight: 139.11
MDL number: MFCD00010100
EINECS: 210-198-2
| Pack Size | Price | Stock | Quantity |
| 5g | RMB24.00 | In Stock |
|
| 25G | RMB54.40 | In Stock |
|
| 100G | RMB120.80 | In Stock |
|
| 500G | RMB510.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 258-261 °C(lit.) |
| Boiling point: | 255.04°C (rough estimate) |
| Density | 1.4429 (rough estimate) |
| refractive index | 1.5423 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 0.1 M NaOH: 0.1 g/mL, clear |
| pka | 2.40±0.20(Predicted) |
| form | Powder |
| color | White to light yellow |
| BRN | 119028 |
| InChI | InChI=1S/C6H5NO3/c8-5-4(6(9)10)2-1-3-7-5/h1-3H,(H,7,8)(H,9,10) |
| InChIKey | UEYQJQVBUVAELZ-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC=C1C(O)=O |
| CAS DataBase Reference | 609-71-2(CAS DataBase Reference) |
Description and Uses
2-Hydroxynicotinic acid is used in chemical synthesis. It is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuff fields.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |




