A4774712
Heptanophenone , ≥98.0%(GC) , 1671-75-6
CAS NO.:1671-75-6
Empirical Formula: C13H18O
Molecular Weight: 190.28
MDL number: MFCD00009539
EINECS: 216-802-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB145.60 | In Stock |
|
| 25G | RMB497.60 | In Stock |
|
| 100G | RMB1391.20 | In Stock |
|
| 500g | RMB4392.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 17 °C (lit.) |
| Boiling point: | 155 °C/15 mmHg (lit.) |
| Density | 0.946 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| form | Liquid |
| color | Clear slightly yellow to yellow |
| BRN | 1865692 |
| InChI | InChI=1S/C13H18O/c1-2-3-4-8-11-13(14)12-9-6-5-7-10-12/h5-7,9-10H,2-4,8,11H2,1H3 |
| InChIKey | UXMQORVHJMUQFD-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(=O)CCCCCC |
| CAS DataBase Reference | 1671-75-6(CAS DataBase Reference) |
| EPA Substance Registry System | Heptanophenone (1671-75-6) |
Description and Uses
1-Phenyl-1-heptanone is a useful building block for organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29143900 |
| Storage Class | 10 - Combustible liquids |







