A4777312
7-Hydroxycoumarin-4-acetic Acid , ≥97% , 6950-82-9
Synonym(s):
Umbelliferone-4-acetic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB70.56 | In Stock |
|
| 5G | RMB272.80 | In Stock |
|
| 10g | RMB541.04 | In Stock |
|
| 25G | RMB1233.60 | In Stock |
|
| 100g | RMB3694.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 212 °C (dec.) (lit.) |
| Boiling point: | 523.5±50.0 °C(Predicted) |
| Density | 1.511±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: soluble |
| form | Crystalline Powder |
| pka | 4.24±0.10(Predicted) |
| color | Off-white to pale yellow |
| λmax | 326nm(MeOH)(lit.) |
| BRN | 204777 |
| InChI | InChI=1S/C11H8O5/c12-7-1-2-8-6(3-10(13)14)4-11(15)16-9(8)5-7/h1-2,4-5,12H,3H2,(H,13,14) |
| InChIKey | BNHPMQBVNXMPDU-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=CC=C2C(CC(O)=O)=C1 |
| CAS DataBase Reference | 6950-82-9(CAS DataBase Reference) |
Description and Uses
Fluorogenic substrate
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 8 |
| HS Code | 29322985 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







