A4778712
1-(4-Hydroxyphenyl)piperazine , ≥98% , 56621-48-8
Synonym(s):
4-Piperazinophenol
CAS NO.:56621-48-8
Empirical Formula: C10H14N2O
Molecular Weight: 178.23
MDL number: MFCD00066156
EINECS: 260-289-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB33.60 | In Stock |
|
| 10g | RMB63.20 | In Stock |
|
| 25G | RMB103.20 | In Stock |
|
| 50g | RMB199.20 | In Stock |
|
| 100G | RMB372.80 | In Stock |
|
| 500g | RMB1855.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220 °C |
| Boiling point: | 371.3±27.0 °C(Predicted) |
| Density | 1.141±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 12.18±0.30(Predicted) |
| color | Brownish |
| BRN | 150964 |
| InChI | InChI=1S/C10H14N2O/c13-10-3-1-9(2-4-10)12-7-5-11-6-8-12/h1-4,11,13H,5-8H2 |
| InChIKey | GPEOAEVZTOQXLG-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(N2CCNCC2)C=C1 |
| LogP | 0.374 |
| CAS DataBase Reference | 56621-48-8(CAS DataBase Reference) |
Description and Uses
1-(4-Hydroxyphenyl)piperazine can be used as an intermediate for ketoconazole.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS05,GHS06 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H301-H314-H318 |
| Precautionary statements | P261-P305+P351+P338-P260h-P301+P310a-P303+P361+P353-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN3263 |
| WGK Germany | 3 |
| F | 10-34 |
| Hazard Note | Irritant |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29335990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| REACH Registrations | Active |








