A4782512
5-(4-Hydroxyphenyl)hydantoin , ≥98.0% , 2420-17-9
CAS NO.:2420-17-9
Empirical Formula: C9H8N2O3
Molecular Weight: 192.17
MDL number: MFCD00044002
EINECS: 219-340-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB194.40 | In Stock |
|
| 25G | RMB810.40 | In Stock |
|
| 100g | RMB2375.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >260°C |
| Boiling point: | 273.7℃[at 101 325 Pa] |
| Density | 1.408 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.67±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | 1.29g/L at 20℃ |
| InChI | InChI=1S/C9H8N2O3/c12-6-3-1-5(2-4-6)7-8(13)11-9(14)10-7/h1-4,7,12H,(H2,10,11,13,14) |
| InChIKey | UMTNMIARZPDSDI-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C2=CC=C(O)C=C2)C(=O)N1 |
| LogP | -0.03 at 20℃ |
| CAS DataBase Reference | 2420-17-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS09 |
| Signal word | Danger |
| Hazard statements | H302+H312-H315-H318-H411 |
| Precautionary statements | P264-P270-P273-P280-P301+P312+P330-P302+P352+P312-P305+P351+P338+P310-P332+P313-P391-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| RIDADR | UN3077 |
| WGK Germany | WGK 3 |
| HS Code | 2933.21.0000 |
| HazardClass | 9 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







