A4783512
DL-5-Hydroxytryptophan , 99% , 56-69-9
CAS NO.:56-69-9
Empirical Formula: C11H12N2O3
Molecular Weight: 220.22
MDL number: MFCD00005651
EINECS: 200-284-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB80.80 | In Stock |
|
| 25G | RMB221.60 | In Stock |
|
| 100G | RMB737.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 298-300°C |
| Boiling point: | 361.16°C (rough estimate) |
| Density | 1.484 |
| refractive index | 1.5200 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 2.22±0.10(Predicted) |
| color | Off-White to Pale Beige |
| Water Solubility | Soluble in water (4 mg/ml at 25°C), methanol. |
| Merck | 14,4847 |
| BRN | 88199 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | 1S/C11H12N2O3/c12-9(11(15)16)3-6-5-13-10-2-1-7(14)4-8(6)10/h1-2,4-5,9,13-14H,3,12H2,(H,15,16) |
| InChIKey | LDCYZAJDBXYCGN-UHFFFAOYSA-N |
| SMILES | NC(Cc1c[nH]c2ccc(O)cc12)C(O)=O |
| LogP | -0.292 (est) |
| CAS DataBase Reference | 56-69-9(CAS DataBase Reference) |
| EPA Substance Registry System | Tryptophan, 5-hydroxy- (56-69-9) |
Description and Uses
5-Hydroxytryptophan (5-HTP) is an aromatic amino acid naturally produced by the body from the essential amino acid L-tryptophan (LT). Produced commercially by extraction from the seeds of the African plant, Griffonia simplicifolia, 5-HTP has been used clinically for over 30 years. The clinical efficacy of 5-HTP is due to its ability to increase production of serotonin in the brain.
A metabolite of Tryptophan. 5-Hydroxytryptophan (5-HTP) is a direct 5-hydroxytryptamine (5-HT) precursor used to assess central serotonergic function.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H332-H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | YN7100000 |
| TSCA | TSCA listed |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 56-69-9(Hazardous Substances Data) |





