A4785712
2-Hydroxy-3-methylbutyric acid , ≥98% , 4026-18-0
Synonym(s):
2-Hydroxyisovaleric acid
CAS NO.：4026-18-0
Empirical Formula: C5H10O3
Molecular Weight: 118.13
MDL number: MFCD00004242
EINECS: 223-697-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB74.40 | In Stock |
|
| 5G | RMB264.80 | In Stock |
|
| 25g | RMB889.60 | In Stock |
|
| 100g | RMB3292.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-87 °C (lit.) |
| Boiling point: | 120-125 °C(Press: 17 Torr) |
| Density | 1.136±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in dimethyl sulfoxide and methanol. |
| pka | 3.87±0.16(Predicted) |
| form | Solid |
| color | White |
| InChI | InChI=1S/C5H10O3/c1-3(2)4(6)5(7)8/h3-4,6H,1-2H3,(H,7,8) |
| InChIKey | NGEWQZIDQIYUNV-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C(O)C(C)C |
| LogP | 0.013 (est) |
| CAS DataBase Reference | 4026-18-0(CAS DataBase Reference) |
Description and Uses
2-Hydroxy-3-methylbutyric Acid is a α-hydroxylated butyric acid derivative used as a marker in chemical diagnosis of organic aciduria and other inborn errors. 2-Hydroxy-3-methylbutyric Acid is also us ed as a metabolomic biomarkers in preeclampsia.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
