A4786256
Ethyl2,6-dichloro-5-fluoro-β-oxo-3-pyridinepropionate , 98% , 96568-04-6
CAS NO.:96568-04-6
Empirical Formula: C10H8Cl2FNO3
Molecular Weight: 280.08
MDL number: MFCD00799535
EINECS: 627-012-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB79.20 | In Stock |
|
| 25g | RMB263.20 | In Stock |
|
| 100g | RMB935.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 68-72 °C (lit.) |
| Boiling point: | 349.9±37.0 °C(Predicted) |
| Density | 1.4602 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.43±0.50(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C10H8Cl2FNO3/c1-2-17-8(16)4-7(15)5-3-6(13)10(12)14-9(5)11/h3H,2,4H2,1H3 |
| InChIKey | IEUHWNLWVMLHHC-UHFFFAOYSA-N |
| SMILES | C(C1C=C(F)C(Cl)=NC=1Cl)(=O)CC(=O)OCC |
| CAS DataBase Reference | 96568-04-6(CAS DataBase Reference) |
Description and Uses
Enoxacin intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





