A4787812
4-(1H-Imidazol-1-yl)benzaldehyde , ≥97.0%(GC) , 10040-98-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB103.20 | In Stock |
|
| 25g | RMB440.00 | In Stock |
|
| 100g | RMB1452.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155 °C(lit.) |
| Boiling point: | 351.1±25.0 °C(Predicted) |
| Density | 1.15±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 5.07±0.10(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C10H8N2O/c13-7-9-1-3-10(4-2-9)12-6-5-11-8-12/h1-8H |
| InChIKey | DCICUQFMCRPKHZ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(N2C=NC=C2)C=C1 |
| CAS DataBase Reference | 10040-98-9(CAS DataBase Reference) |
Description and Uses
4-(1H-Imidazol-1-yl)benzaldehyde could be used to synthesis (E)-3-[4-(1H-imidazol-1-yl)phenyl]-1-(4-methylphenyl)prop-2-en-1-one with 4′-methylacetophenone through Claisen–Schmidt condensation. This novel compound is suitable for anti-aspergillus activity study[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



