A4789012
9H-Carbazole-9-ethanol , ≥95% , 1484-14-6
CAS NO.:1484-14-6
Empirical Formula: C14H13NO
Molecular Weight: 211.26
MDL number: MFCD00518704
EINECS: 604-632-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB167.20 | In Stock |
|
| 5G | RMB534.40 | In Stock |
|
| 25G | RMB1919.20 | In Stock |
|
| 100g | RMB3820.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 78-82 °C(lit.) |
| Boiling point: | 220 °C(Press: 5 Torr) |
| Density | 1.17±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 14.09±0.10(Predicted) |
| form | Solid |
| color | White to yellow |
| InChI | InChI=1S/C14H13NO/c16-10-9-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,16H,9-10H2 |
| InChIKey | IIKVAWLYHHZRGV-UHFFFAOYSA-N |
| SMILES | N1(CCO)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| CAS DataBase Reference | 1484-14-6(CAS DataBase Reference) |
Description and Uses
9H-Carbazole-9-ethanol may be used to synthesize 2-(9H-carbazol-9-yl)ethyl methacrylate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |




