A4789412
1,1,1,3,5,5,5-Heptamethyltrisiloxane , ≥98.0%(GC) , 1873-88-7
Synonym(s):
1,1,1,3,5,5,5-Heptamethyltrisiloxane
CAS NO.:1873-88-7
Empirical Formula: C7H22O2Si3
Molecular Weight: 222.5
MDL number: MFCD00048000
EINECS: 217-496-1
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB46.40 | In Stock |
|
| 50ML | RMB79.20 | In Stock |
|
| 100ML | RMB142.40 | In Stock |
|
| 250ML | RMB302.40 | In Stock |
|
| 500ML | RMB519.20 | In Stock |
|
| 1L | RMB1118.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 142 °C (lit.) |
| Density | 0.819 g/mL at 25 °C (lit.) |
| vapor pressure | 8.5hPa at 25℃ |
| refractive index | n |
| Flash point: | 82 °F |
| storage temp. | 15-25°C |
| solubility | Chloroform (Soluble), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.8136 |
| Water Solubility | Miscible with acetone, ethanol, diethyl ether. Insoluble in water. |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| BRN | 1748455 |
| Stability: | Stable. Flammable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C7H22O2Si3/c1-10(8-11(2,3)4)9-12(5,6)7/h10H,1-7H3 |
| InChIKey | QNWOFLWXQGHSRH-UHFFFAOYSA-N |
| SMILES | C[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| LogP | 6.2 at 20℃ |
| CAS DataBase Reference | 1873-88-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Trisiloxane, 1,1,1,3,5,5,5-heptamethyl-,(1873-88-7) |
| EPA Substance Registry System | Trisiloxane, 1,1,1,3,5,5,5-heptamethyl- (1873-88-7) |
Description and Uses
Bis (trimethylsiloxy) methylsilane acts as an important raw material and intermediate used in organic synthesis, pharmaceutical and dyestuff. For example, it can be used for the platinum-catalyzed aromatic C-H silylation of arenes. It can also be used for the silylation of aryl iodides.
1,1,1,3,5,5,5-Heptamethyltrisiloxane can be used for the aromatic C-H silylation of arenes in the presence of a platinum complex catalyst.
It can also be used as a reagent to synthesize:
- 3-Octyl-1,1,1,3,5,5,5-heptamethyltrisiloxane, an agricultural adjuvant and sensory performance enhancer used in cosmetic formulations.
- Isoindigo-based conjugated polymer with siloxane-terminated solubilizing group.
- Monosiloxy esters with a variety of acids.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 2 Skin Irrit. 2 STOT SE 3 |







