A4791212
6-Hydroxy-3-coumaranone , ≥97% , 6272-26-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB36.00 | In Stock |
|
| 5G | RMB108.80 | In Stock |
|
| 25g | RMB443.20 | In Stock |
|
| 100g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 242-246 °C (dec.) (lit.) |
| Boiling point: | 369.3±42.0 °C(Predicted) |
| Density | 1.436±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.63±0.20(Predicted) |
| color | Light yellow to Yellow to Orange |
| Water Solubility | Slightly soluble in water. |
| λmax | 319nm(MeOH)(lit.) |
| BRN | 121444 |
| InChI | InChI=1S/C8H6O3/c9-5-1-2-6-7(10)4-11-8(6)3-5/h1-3,9H,4H2 |
| InChIKey | GBDMODVZBPFQKI-UHFFFAOYSA-N |
| SMILES | O1C2=CC(O)=CC=C2C(=O)C1 |
| CAS DataBase Reference | 6272-26-0(CAS DataBase Reference) |
Description and Uses
6-Hydroxy-2,3-dihydrobenzo[b]furan-3-one, is used as a pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





