PRODUCT Properties
| Melting point: | 109-113 °C (lit.) |
| Boiling point: | 310℃ |
| Density | 1.305 |
| Flash point: | 131℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol (Slightly) |
| form | Solid |
| pka | 10.27±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| λmax | 311nm(Cyclohexane)(lit.) |
| InChI | InChI=1S/C9H8O2/c10-7-3-1-2-6-4-5-8(11)9(6)7/h1-3,10H,4-5H2 |
| InChIKey | HFMZPBSZKCDKOR-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2O)CC1 |
| CAS DataBase Reference | 6968-35-0 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29145090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




