A4798312
6-Hydroxy-2-naphthaldehyde , 98% , 78119-82-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB103.20 | In Stock |
|
| 5G | RMB391.20 | In Stock |
|
| 25G | RMB935.20 | In Stock |
|
| 100g | RMB3733.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 178-180 |
| Boiling point: | 373.4±15.0 °C(Predicted) |
| Density | 1.288±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Solid |
| pka | 8.60±0.40(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C11H8O2/c12-7-8-1-2-10-6-11(13)4-3-9(10)5-8/h1-7,13H |
| InChIKey | PRYNJOJHKYNLIS-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C(O)C=C2)=CC=C1C=O |
| CAS DataBase Reference | 78119-82-1(CAS DataBase Reference) |
Description and Uses
6-Hydroxy-2-naphthaldehyde is a fluorophore characterized by a simple molecular structure and photophysical properties. It serves as a precursor in the preparation of the fluorescent probe AENO by coupling with potassium allyltrifluoroborate in the presence of ammonia solution[4].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 52 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2912490090 |
| Storage Class | 11 - Combustible Solids |




