PRODUCT Properties
| Melting point: | 21°C |
| Boiling point: | 245 °C(lit.) |
| Density | 1.08 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| pka | 10.27±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| λmax | 325nm(MeOH)(lit.) |
| InChI | InChI=1S/C9H10O2/c1-6-3-4-8(7(2)10)9(11)5-6/h3-5,11H,1-2H3 |
| InChIKey | LYKDOWJROLHYOT-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(C)C=C1O)C |
| CAS DataBase Reference | 6921-64-8(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanone, 1-(2-hydroxy-4-methylphenyl)- (6921-64-8) |
Description and Uses
2′-Hydroxy-4′-methylacetophenone is found in Angelica koreana roots and a study was done in which it could be useful for natural acaricides against three mite species.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2914500090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




