A4800912
Hydroxypropyl Acrylate (mixture of 2-Hydroxypropyl and 2-Hydroxy-1-methylethyl Acrylate) (stabilized with MEHQ) , >90.0%(GC) , 25584-83-2
CAS NO.：25584-83-2
Empirical Formula: C6H10O3
Molecular Weight: 130.14
MDL number: MFCD04113589
EINECS: 247-118-0
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB31.20 | In Stock |
|
| 100ml | RMB40.00 | In Stock |
|
| 500ML | RMB143.20 | In Stock |
|
| 2.5L | RMB503.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -92°C |
| Boiling point: | 77 °C5 mm Hg(lit.) |
| Density | 1.044 g/mL at 25 °C(lit.) |
| vapor density | 4.5 (vs air) |
| vapor pressure | 1Pa at 20℃ |
| refractive index | n |
| Flash point: | 193 °F |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | The water solubility of hydroxypropyl acrylate is estimated to be 307g/L(25°C) |
| Cosmetics Ingredients Functions | FILM FORMING |
| InChI | 1S/2C6H10O3/c1-3-6(8)9-4-5(2)7;1-3-6(8)9-5(2)4-7/h2*3,5,7H,1,4H2,2H3 |
| InChIKey | QZPSOSOOLFHYRR-UHFFFAOYSA-N |
| SMILES | CC(O)COC(=O)C=C.CC(CO)OC(=O)C=C |
| LogP | 0.2 at 25℃ |
| CAS DataBase Reference | 25584-83-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Hydroxypropyl acrylate(25584-83-2) |
| EPA Substance Registry System | Hydroxypropyl acrylate (25584-83-2) |
Description and Uses
Hydroxypropyl acrylate is an acrylic monomer for use in UV inks, lacquers, adhesives, etc. [2-Hydroxy-1-propylacrylate (67%)+1-hydroxy-2-propylacrylate(33%).
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331-H314-H317-H412 |
| Precautionary statements | P261-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | T |
| Risk Statements | 23/24/25-34-43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1760 8/PG 3 |
| WGK Germany | 1 |
| RTECS | UD3610000 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29161290 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 3 Eye Dam. 1 Skin Corr. 1B Skin Sens. 1 |
| Hazardous Substances Data | 25584-83-2(Hazardous Substances Data) |
