A4805612
1,1,3,3,5,5-Hexamethyltrisiloxane , >97.0%(GC) , 1189-93-1
CAS NO.:1189-93-1
Empirical Formula: C6H20O2Si3
Molecular Weight: 208.48
MDL number: MFCD00039788
EINECS: 214-716-8
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB139.20 | In Stock |
|
| 25ML | RMB447.20 | In Stock |
|
| 100ML | RMB1343.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -67°C |
| Boiling point: | 128 °C (lit.) |
| Density | 0.822 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 59 °F |
| storage temp. | Flammables area |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 0.822 |
| Water Solubility | Slightly miscible with water. |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| Sensitive | Moisture Sensitive |
| BRN | 1746341 |
| InChI | 1S/C6H20O2Si3/c1-9(2)7-11(5,6)8-10(3)4/h9-10H,1-6H3 |
| InChIKey | HZBDPZBVINJJET-UHFFFAOYSA-N |
| SMILES | [H][Si](C)(C)O[Si](C)(C)O[Si]([H])(C)C |
| CAS DataBase Reference | 1189-93-1(CAS DataBase Reference) |
| EPA Substance Registry System | Trisiloxane, 1,1,3,3,5,5-hexamethyl- (1189-93-1) |
Description and Uses
1,1,3,3,5,5-Hexamethyltrisiloxane is involved in the preparation of 2-bis(3-allyl-4-hydroxyphenyl)hexafluoropropane, which is associated with inorganic siloxane polymer and used as a coating material for the detection of toxic chemical warfare agents. It is also used as a silylating agent and to prepare 1,5-Bis[2-(1,2-epoxycyclohex-4-yl)ethyl]-1,1,3,3,5,5-hexamethyltrisiloxane from 4-vinyl-1-cyclohexene-1,2-epoxide by hydrosilylation.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F |
| Risk Statements | 11 |
| Safety Statements | 16-23-24/25 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| F | 10 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







