A4813612
Homosulfamine Hydrochloride , >98.0%(HPLC) , 138-37-4
Synonym(s):
4-Homosulfanilamide;Mafenide;Marfanil
CAS NO.:138-37-4
Empirical Formula: C7H11ClN2O2S
Molecular Weight: 222.69
MDL number: MFCD00013005
EINECS: 205-325-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5g | RMB79.20 | In Stock |
|
| 25G | RMB279.20 | In Stock |
|
| 100G | RMB999.20 | In Stock |
|
| 250G | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 261-263 °C(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White |
| Merck | 13,5671 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| Cosmetics Ingredients Functions | ANTIMICROBIAL |
| InChI | InChI=1S/C7H10N2O2S.ClH/c8-5-6-1-3-7(4-2-6)12(9,10)11;/h1-4H,5,8H2,(H2,9,10,11);1H |
| InChIKey | SIACJRVYIPXFKS-UHFFFAOYSA-N |
| SMILES | C1(S(=O)(=O)N)=CC=C(CN)C=C1.Cl |
| CAS DataBase Reference | 138-37-4(CAS DataBase Reference) |
Description and Uses
Antibacterial;Inhibitor of folic acid biosynthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H317 |
| Precautionary statements | P280 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 42/43 |
| Safety Statements | 22-36/37-45 |
| WGK Germany | 2 |
| RTECS | XT5425000 |
| HS Code | 29350090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Skin Sens. 1 |
| Toxicity | LD50 in rats, mice (mg/kg): 1170, 900 i.v. (Skulan, Hoppe) |






