A4817612
3-Hydroxy-4-nitrobenzoic Acid , >96.0% , 619-14-7
CAS NO.:619-14-7
Empirical Formula: C7H5NO5
Molecular Weight: 183.12
MDL number: MFCD00007110
EINECS: 210-580-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB35.20 | In Stock |
|
| 25G | RMB77.60 | In Stock |
|
| 100G | RMB228.80 | In Stock |
|
| 250G | RMB535.20 | In Stock |
|
| 500g | RMB1055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-231 °C (lit.) |
| Boiling point: | 316.77°C (rough estimate) |
| Density | 1.6074 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | 1.08g/l (calculated) |
| pka | 3.30±0.10(Predicted) |
| form | Powder |
| color | Yellow to brown |
| Water Solubility | insoluble |
| BRN | 2107564 |
| InChI | InChI=1S/C7H5NO5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11) |
| InChIKey | XLDLRRGZWIEEHT-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C([N+]([O-])=O)C(O)=C1 |
| CAS DataBase Reference | 619-14-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Hydroxy-4-nitrobenzoic acid(619-14-7) |
Description and Uses
3-Hydroxy-4-nitrobenzoic acid is a compound that is capable of inhibiting chloroplast development in linseed and oat seedlings. 3-Hydroxy-4-nitrobenzoic acid also exhibits inhibitory effects on Ras proteins, making them potentially useful compounds in treating cancer.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29182990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |





