A4817912
Hexadecanamide , >95.0%(GC) , 629-54-9
CAS NO.:629-54-9
Empirical Formula: C16H33NO
Molecular Weight: 255.44
MDL number: MFCD00025534
EINECS: 211-095-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB121.60 | In Stock |
|
| 5g | RMB425.60 | In Stock |
|
| 10G | RMB1246.40 | In Stock |
|
| 25G | RMB1496.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106°C |
| Boiling point: | 236 °C / 12mmHg |
| Density | 1.0000 |
| refractive index | 1.4545 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 16.61±0.40(Predicted) |
| color | White to Off-White |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChI | InChI=1S/C16H33NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H2,17,18) |
| InChIKey | HSEMFIZWXHQJAE-UHFFFAOYSA-N |
| SMILES | C(N)(=O)CCCCCCCCCCCCCCC |
| LogP | 6.200 (est) |
| EPA Substance Registry System | Hexadecanamide (629-54-9) |
Description and Uses
Hexadecanamide can be used to prepare tissue regeneration.






