A4825012
4-Hydroxydiphenylamine , >98.0%(HPLC) , 122-37-2
CAS NO.:122-37-2
Empirical Formula: C12H11NO
Molecular Weight: 185.22
MDL number: MFCD00020142
EINECS: 204-538-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5G | RMB111.20 | In Stock |
|
| 25G | RMB263.20 | In Stock |
|
| 100G | RMB839.20 | In Stock |
|
| 500G | RMB2232.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-73°C |
| Boiling point: | 190°C |
| Density | 1.0936 (rough estimate) |
| refractive index | 1.5300 (estimate) |
| Flash point: | 209°C |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Ethanol: Soluble: =10 mg/mlPBS (pH 7.2): Soluble: =10 mg/ml |
| form | powder to lump |
| pka | 10.46±0.13(Predicted) |
| color | Gray, solid leaflets |
| BRN | 511942 |
| InChI | InChI=1S/C12H11NO/c14-12-8-6-11(7-9-12)13-10-4-2-1-3-5-10/h1-9,13-14H |
| InChIKey | JTTMYKSFKOOQLP-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(NC2=CC=CC=C2)C=C1 |
| CAS DataBase Reference | 122-37-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4-(phenylamino)-(122-37-2) |
| EPA Substance Registry System | Phenol, 4-(phenylamino)- (122-37-2) |
Description and Uses
4-Hydroxydiphenylamine is used as a reactant in the preparation of iron methylisopropylglyoxime dimethylpyridine/dimethylaminopyridine/phenylaminophenol/imidazolidone complexes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Warning |
| Hazard statements | H303-H318-H315-H319 |
| Precautionary statements | P280i-P305+P351+P338-P310a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 37/38-41-22-21 |
| Safety Statements | 26-36/37/39-36/39 |
| RIDADR | UN2811 |
| RTECS | SJ6950000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29222990 |
| Toxicity | LD50 oral in rat: 3300mg/kg |






