A4825612
4-Hydroxy-3-nitrophenylarsonic Acid , >98.0%(HPLC) , 121-19-7
Synonym(s):
2-Nitrophenol-4-arsonic acid;4-Hydroxy-3-nitrobenzenearsonic acid
CAS NO.:121-19-7
Empirical Formula: C6H6AsNO6
Molecular Weight: 263.04
MDL number: MFCD00007112
EINECS: 204-453-7
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ≥300 °C(lit.) |
| Boiling point: | 537.3±60.0 °C(Predicted) |
| Density | 2.02 g/cm3 |
| storage temp. | 0-6°C |
| solubility | insoluble in Ether |
| pka | 3.51±0.10(Predicted) |
| form | liquid |
| color | Light yellow to Yellow |
| Water Solubility | <0.1 g/100 mL at 23 ºC |
| Merck | 14,8273 |
| BRN | 1976533 |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical |
| InChI | 1S/C6H6AsNO6/c9-6-2-1-4(7(10,11)12)3-5(6)8(13)14/h1-3,9H,(H2,10,11,12) |
| InChIKey | XMVJITFPVVRMHC-UHFFFAOYSA-N |
| SMILES | Oc1ccc(cc1[N+]([O-])=O)[As](O)(O)=O |
| CAS DataBase Reference | 121-19-7(CAS DataBase Reference) |
| EPA Substance Registry System | Roxarsone (121-19-7) |
Description and Uses
antiinfective, preservative
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H410 |
| Precautionary statements | P261-P264-P270-P273-P301+P310-P304+P340+P311 |
| Hazard Codes | T,N |
| Risk Statements | 23/25-50/53 |
| Safety Statements | 20/21-28-45-60-61 |
| RIDADR | UN 3465 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | CY5250000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 121-19-7(Hazardous Substances Data) |
| Toxicity | LD50 in rats, chickens (mg/kg): 155, 110-123 orally; 66, 34 i.p. (Kerr) |





