A4836412
Hexadecafluorosebacic Acid , >96.0%(T) , 307-78-8
Synonym(s):
Hexadecafluorosebacic acid;Perfluorodecanedioic acid;Perfluorosebacic acid
| Pack Size | Price | Stock | Quantity |
| 1G | RMB124.80 | In Stock |
|
| 5G | RMB378.40 | In Stock |
|
| 25G | RMB1439.20 | In Stock |
|
| 100g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 151-160 °C(lit.) |
| Boiling point: | 225°C 60mm |
| Density | 1.7502 (estimate) |
| form | powder to crystal |
| pka | 0.22±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1898292 |
| InChI | 1S/C10H2F16O4/c11-3(12,1(27)28)5(15,16)7(19,20)9(23,24)10(25,26)8(21,22)6(17,18)4(13,14)2(29)30/h(H,27,28)(H,29,30) |
| InChIKey | YPCSMEGZIYWAAZ-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)=O |
| CAS DataBase Reference | 307-78-8(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluorosebacic acid (307-78-8) |
Description and Uses
Reactant involved in:
- Studies of hydrogen peroxide disproportionation kinetics of manganese phenanthroline perfluorosebacato polymeric complex
- Synthesis of cobalt phenanthroline perfluorosebacic acid complex
- Reactions with zinc salt and phenanthroline
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372 |
| Precautionary statements | P202-P260-P263-P301+P312-P304+P340+P312-P308+P313 |
| target organs | Liver |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29171900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Lact. Repr. 1B STOT RE 1 |
