PRODUCT Properties
| Melting point: | 78-81 °C(lit.) |
| Boiling point: | 111.5 °C10 mm Hg(lit.) |
| Density | 1.4048 (estimate) |
| Flash point: | >110°C |
| form | powder to crystal |
| pka | 12.68±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1766258 |
| InChI | 1S/C5H6F6O2/c6-3(7,1-12)5(10,11)4(8,9)2-13/h12-13H,1-2H2 |
| InChIKey | IELVMUPSWDZWSD-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)CO |
| CAS DataBase Reference | 376-90-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,5-Pentanediol, 2,2,3,3,4,4-hexafluoro- (376-90-9) |
Description and Uses
2,2,3,3,4,4-Hexafluoro-1,5-pentanediol can be used for the preparation of cyclic and acyclic polyfluorosiloxanes as precursors to per- and polyfluoroethers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H302 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi,T |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-36/37-26 |
| WGK Germany | 3 |
| RTECS | SA0750000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | IRRITANT, TOXIC |
| HS Code | 29055900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
