A4851312
Benzethonium Chloride , Analysis standard , 121-54-0
Synonym(s):
(Diisobutylphenoxyethoxyethyl)dimethylbenzylammonium chloride;(Diisobutylphenoxyethoxyethyl)dimethylbenzylammonium chloride solution;Benzethonium chloride;N-Benzyl-N,N-dimethyl-N-[4-(1.1.3.3-tetramethylbutyl)-phenoxyethoxyethyl]ammonium chloride;Phemerol chloride
CAS NO.:121-54-0
Empirical Formula: C27H42ClNO2
Molecular Weight: 448.08
MDL number: MFCD00011742
EINECS: 204-479-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB527.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-164 °C (lit.) |
| Boiling point: | 162℃[at 101 325 Pa] |
| bulk density | 440kg/m3 |
| Density | 0.998 g/mL at 20 °C |
| vapor pressure | < 0.001 hPa @ 2°C |
| refractive index | 1.5650 (estimate) |
| storage temp. | 2-8°C |
| solubility | H2O: 0.1 M at 20 °C, clear, colorless |
| form | Liquid |
| color | White |
| Odor | Odorless |
| PH Range | 5.5 - 7.5 |
| PH | 5.5-7.5 (25℃, 0.1M in H2O) |
| Water Solubility | 1-5 g/100 mL at 18 ºC |
| Sensitive | Hygroscopic |
| Merck | 14,1074 |
| BRN | 3898548 |
| Stability: | Stability Stable, but hygroscopic. Incompatible with strong oxidizing agents, soap, anionic detergents, nitrates, acids. Light sensitive. |
| Cosmetics Ingredients Functions | PRESERVATIVE ANTIMICROBIAL SURFACTANT - DISPERSING DEODORANT |
| Cosmetic Ingredient Review (CIR) | Benzethonium chloride (121-54-0) |
| InChI | 1S/C27H42NO2.ClH/c1-26(2,3)22-27(4,5)24-13-15-25(16-14-24)30-20-19-29-18-17-28(6,7)21-23-11-9-8-10-12-23;/h8-16H,17-22H2,1-7H3;1H/q+1;/p-1 |
| InChIKey | UREZNYTWGJKWBI-UHFFFAOYSA-M |
| SMILES | [Cl-].[N+](CCOCCOc2ccc(cc2)C(CC(C)(C)C)(C)C)(Cc1ccccc1)(C)C |
| LogP | 1.08 at 20℃ |
| CAS DataBase Reference | 121-54-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzethonium chloride (121-54-0) |
| Absorption | cut-off at 300nm in H2O at 0.1M |
Description and Uses
Hyamine(R) 1622 Crystals is a FDA accepted ingredient for topical applications. It can be used as a bactericide, deodorant, or as a preservative in various applications including those in personal care, veterinary and pharmaceutical.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H314-H410 |
| Precautionary statements | P260-P273-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 |
| Hazard Codes | Xn,N,C |
| Risk Statements | 22-37/38-41-36-36/37/38-20/21/22-50/53-34-52/53 |
| Safety Statements | 26-36/39-24/25-36/37/39-61-45 |
| RIDADR | UN1759 |
| WGK Germany | 2 |
| RTECS | BO7175000 |
| F | 8 |
| Autoignition Temperature | 380°C |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 6.1A - Combustible, acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Corr. 1B |
| Hazardous Substances Data | 121-54-0(Hazardous Substances Data) |
| Toxicity | LD50 i.v. in mice: 29.5 mg/kg (Weiss) |







