A4860712
Hydroquinonesulfonic acid potassium salt , ≥98% , 21799-87-1
Synonym(s):
2,5-Dihydroxybenzenesulfonic acid potassium salt;Hydroquinone monosulfonic acid potassium salt;Potassium 2,5-dihydroxybenzenesulfonate
CAS NO.：21799-87-1
Empirical Formula: C6H7KO5S
Molecular Weight: 230.28
MDL number: MFCD00007475
EINECS: 244-584-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB23.20 | In Stock |
|
| 100G | RMB86.40 | In Stock |
|
| 500g | RMB378.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 251 °C (dec.)(lit.) |
| Boiling point: | 591.05℃[at 101 325 Pa] |
| Density | 1.74[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Store below +30°C. |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | soluble |
| BRN | 5187027 |
| Stability: | Stable. Incompatible with bases, oxidizing agents. |
| InChI | InChI=1S/C6H6O5S.K.H/c7-4-1-2-5(8)6(3-4)12(9,10)11;;/h1-3,7-8H,(H,9,10,11);; |
| InChIKey | NFNMIXKGPIRZMQ-UHFFFAOYSA-N |
| SMILES | S(C1C=C(O)C=CC=1O)(O)(=O)=O.[KH] |
| LogP | -3.912 at 25℃ |
| CAS DataBase Reference | 21799-87-1(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonic acid, 2,5-dihydroxy-, monopotassium salt (21799-87-1) |
Description and Uses
It is employed in the synthesis and properties of sulfonated polyarylene ether nitrile copolymers for PEM with high thermal stability.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 2 |
| TSCA | Yes |
| HS Code | 29082000 |
