A4864512
2-<WBR>Hydroxynicotinaldehyde<img src="/content/dam/sigma-aldrich/head/search/new.png" alt="New" /> , 97% , 36404-89-4
Synonym(s):
2-Hydroxy-pyridine-3-carbaldehyde;TDG4
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB64.80 | In Stock |
|
| 500MG | RMB127.20 | In Stock |
|
| 1G | RMB239.20 | In Stock |
|
| 5G | RMB1039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-222° |
| Boiling point: | 50 °C(Press: 80 Torr) |
| Density | 1.365±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 10.18±0.10(Predicted) |
| form | powder or crystals |
| Appearance | White to light yellow Solid |
| InChI | InChI=1S/C6H5NO2/c8-4-5-2-1-3-7-6(5)9/h1-4H,(H,7,9) |
| InChIKey | DNTYEVWEOFZXFE-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC=C1C=O |
Description and Uses
This reagent was used as a catalytic transient directing group by Jin-Quan Yu′s lab for Pd(II)-catalyzed γ-C(sp3)-H arylation to couple free primary amines with aryl iodides. Reactions included Pd(OAc)2 683124 and low catalyst and directing group loading.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 26-24/25 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |







