A4890812
1H-indazole-7-carboxylic acid , 95% , 677304-69-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB30.40 | In Stock |
|
| 1G | RMB47.20 | In Stock |
|
| 5g | RMB159.20 | In Stock |
|
| 25g | RMB444.80 | In Stock |
|
| 100g | RMB1775.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ca 240℃ |
| Boiling point: | 443.7±18.0 °C(Predicted) |
| Density | 1.506±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.71±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to yellow |
| InChI | InChI=1S/C8H6N2O2/c11-8(12)6-3-1-2-5-4-9-10-7(5)6/h1-4H,(H,9,10)(H,11,12) |
| InChIKey | WBCWIQCXHSXMDH-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2C(O)=O)C=N1 |
Description and Uses
1H-indazole-7-carboxylic Acid is an inhibitor of nitric oxide synthases.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 29339980 |
