A4902912
Homopiperonylamine , 95% , 1484-85-1
CAS NO.：1484-85-1
Empirical Formula: C9H11NO2
Molecular Weight: 165.19
MDL number: MFCD00060509
EINECS: 216-060-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5g | RMB74.40 | In Stock |
|
| 10g | RMB111.20 | In Stock |
|
| 25G | RMB280.00 | In Stock |
|
| 100G | RMB759.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 114 °C |
| Boiling point: | 146-148°C/10 mm |
| Density | 1.2250 |
| refractive index | 1.5620 (estimate) |
| RTECS | SH9670000 |
| storage temp. | -20°C Freezer, Under Inert Atmosphere |
| solubility | Chloroform, Methanol |
| pka | 9.90±0.10(Predicted) |
| form | Liquid |
| color | Colorless to pale yellow |
| Sensitive | Air Sensitive |
| InChI | InChI=1S/C9H11NO2/c10-4-3-7-1-2-8-9(5-7)12-6-11-8/h1-2,5H,3-4,6,10H2 |
| InChIKey | RRIRDPSOCUCGBV-UHFFFAOYSA-N |
| SMILES | O1C2=CC=C(CCN)C=C2OC1 |
| CAS DataBase Reference | 1484-85-1(CAS DataBase Reference) |
Description and Uses
3,4-(Methylenedioxyphenyl)ethylamine is a metabolite of Dopamine analogs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39-24/25 |
| RIDADR | UN2735 |
| HazardClass | 8 |
| HS Code | 29213000 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
