A4908712
5-Hydroxy-3,4-dihydro-2(1h)-quinolinone , 98% , 30389-33-4
CAS NO.:30389-33-4
Empirical Formula: C9H9NO2
Molecular Weight: 163.17
MDL number: MFCD01862194
EINECS: 608-474-6
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB36.80 | In Stock |
|
| 250mg | RMB52.00 | In Stock |
|
| 1G | RMB301.60 | In Stock |
|
| 5g | RMB445.60 | In Stock |
|
| 25g | RMB1923.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 225-227°C |
| Boiling point: | 381.2±42.0 °C(Predicted) |
| Density | 1.282±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.63±0.20(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C9H9NO2/c11-8-3-1-2-7-6(8)4-5-9(12)10-7/h1-3,11H,4-5H2,(H,10,12) |
| InChIKey | UTTJAIFHRUAFED-UHFFFAOYSA-N |
| SMILES | N1C2=C(C(O)=CC=C2)CCC1=O |
| CAS DataBase Reference | 30389-33-4(CAS DataBase Reference) |
Description and Uses
Carteolol (C184450) metabolite.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P271-P260-P280 |
| Hazard Codes | Xi |
| HS Code | 2933499090 |







![Benzo[b]thiophene](https://img.chemicalbook.com/CAS/GIF/95-15-8.gif)